4-Bromo-2-(trifluoromethyl)aniline is an aromatic amine compound containing a bromine atom and a trifluoromethyl group on the benzene ring. It is primarily used as a chemical intermediate in organic synthesis and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 445-02-3
4-bromo-2-(trifluoromethyl)aniline
PHXGKHTWEOPCEW-UHFFFAOYSA-N
C1=CC(=C(C=C1Br)C(F)(F)F)N