3-Oleoylestrone-2,4,16,16-D4 is a deuterated steroid compound used as a research standard. It features a steroid backbone with an oleic acid ester moiety and deuterium atoms at specific positions, making it suitable for analytical and investigative studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 443791-75-1
Diethyl (4-isopropyl-3,5-dimethoxybenzyl)phosphonate
Phosphonate building block for synthesis
2-Trifluoromethylphenol
pharmaceutical research reagent
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
(S)-Methyl 3-Amino-3-(4-methoxyphenyl)-propanoate Hydrochloride
research reagent
Climopax
conjugated estrogen active ingredient
(2,4,16,16-tetradeuterio-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate
IMIPDPVHGGHVNH-IXTWWMPWSA-N
[2H]C1=CC2=C(CCC3C2CCC4(C3CC(C4=O)([2H])[2H])C)C(=C1OC(=O)CCCCCCC/C=C\CCCCCCCC)[2H]