1,3,5-Benzenetricarbonyl trichloride is a chemical compound used as a crosslinking reagent in membrane synthesis. It is commonly employed in research applications for the preparation of porous organic polymers and other membrane materials.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4422-95-1
2,3,4,5-Tetrahydro-1H-benzo[d]azepine
Research chemical intermediate
9H-Fluorene-9,9-dimethanol
research compound
N-Butylboronic acid
Boronic acid research reagent
Heptyl isothiocyanate
chemical research intermediate
benzene-1,3,5-tricarbonyl chloride
UWCPYKQBIPYOLX-UHFFFAOYSA-N
C1=C(C=C(C=C1C(=O)Cl)C(=O)Cl)C(=O)Cl