tert-Butyl Elobixibat is a chemical compound used as a pharmaceutical intermediate. It is a large, flexible molecule with multiple ring systems and functional groups, utilized in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 439088-54-7
Elobixibat
ileal bile acid transporter inhibitor
Tert-Butyl (R)-(2-amino-2-phenylacetyl)glycinate
Pharmaceutical intermediate for peptide synthesis
(S)-2-Amino-5-methoxytetralin (S)-mandelate
Pharmaceutical intermediate for synthesis
P-Hydrazinobenzenesulphonamide
Pharmaceutical intermediate synthesis
N(4)-Desoxychlordiazepoxide
benzodiazepine impurity standard
tert-butyl 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1lambda6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]acetate
XSVUMBDBVUKDQT-DIPNUNPCSA-N
CCCCC1(CN(C2=CC(=C(C=C2S(=O)(=O)C1)OCC(=O)N[C@H](C3=CC=CC=C3)C(=O)NCC(=O)OC(C)(C)C)SC)C4=CC=CC=C4)CCCC