Decafluorobiphenyl is a highly fluorinated biphenyl derivative widely employed as a research intermediate in organic synthesis. Its perfluorinated aromatic rings contribute to unique chemical stability and physical properties, making it valuable in the development of advanced fluorinated materials and building blocks.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 434-90-2
(Oxybis(2,1-phenylene))bis(dicyclohexylphosphine)
ligand for transition metal catalysis
5-Formyl-2-thiopheneboronic acid
research reagent
3-Bromo-5-(trifluoromethyl)pyridine
chemical research intermediate
5-fluorothiophene-2-carboxylic acid
Research compound
1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene
ONUFSRWQCKNVSL-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F