This compound is an isotope-labeled research reagent designed for use in analytical and biochemical studies. It is structurally characterized by a deuterated methyl group and multiple polar functional groups, making it suitable for tracing applications in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 432545-63-6
Methotrexate 5-methyl ester
pharmaceutical intermediate for methotrexate derivatives
Phenanthrene D10
isotope-labeled research compound
CLENBUTEROL D9
isotope-labeled research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
Acetaminophen Dimer-d6
isotope-labeled research compound
2-(Trifluoromethyl)benzoic acid
research compound
4-Ethoxycarbonylphenylboronic acid
Boronic acid research reagent
(2-Carboxyethyl)dimethylsulfonium Chloride
Research biochemical intermediate
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioic acid
FBOZXECLQNJBKD-FUPFOCIHSA-N
[2H]C([2H])([2H])N(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O