Diethyl malonate-d2 is a deuterium-labeled derivative of diethyl malonate, used primarily as a reference standard in organic synthesis. Its incorporation of two deuterium atoms at the methylene position makes it valuable for isotopic labeling studies and mechanistic investigations in chemical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4303-49-5
Methyl D-prolinate
research compound
(R)-3-Phenylpiperidine
research compound
4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride
pharmaceutical intermediate
4'-tert-Butyl-4-chlorobutyrophenone
research intermediate for butyrophenone derivatives
DIETHYL MALONATE
Pharmaceutical intermediate for barbiturates
diethyl 2,2-dideuteriopropanedioate
IYXGSMUGOJNHAZ-BFWBPSQCSA-N
[2H]C([2H])(C(=O)OCC)C(=O)OCC