5-amino-1-benzofuran-2-carboxylic acid is a research compound featuring a benzofuran core with an amino substituent and a carboxylic acid group. It is primarily used as a laboratory reagent in chemical and biological studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 42933-44-8
Nicotinamide hypoxanthine dinucleotidephosphate, reducedform tetrasodium
research compound
[Leu3]-Oxytocin
research compound
Benzyladenine 9-glucoside
plant growth regulator research
P-Tolylmagnesium Bromide
Grignard reagent for organic synthesis
Ethyl 5-aminobenzofuran-2-carboxylate
chemical research reagent
5-Aminobenzofuran-2-carboxylicacidethylester hydrochloride
pharmaceutical intermediate
3-(Hydroxymethyl)benzofuran
research compound
1-benzofuran-2-ylmethanol
research compound
5-amino-1-benzofuran-2-carboxylic acid
IIBKBXGCIDLMOP-UHFFFAOYSA-N
C1=CC2=C(C=C1N)C=C(O2)C(=O)O
—