2,5-Thiophenedicarboxylic acid is a chemical compound featuring a thiophene ring with two carboxylic acid groups. It serves as a building block for organic synthesis, particularly in the production of various organic compounds and materials.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4282-31-9
5-acetylthiophene-2-carboxylic acid
Pharmaceutical intermediate for synthesis
4-Butylbenzoic acid
Building block for organic synthesis
9,9-Dimethyl-9H-fluorene
Building block for organic synthesis
4-bromo-3'-chloro-1,1'-biphenyl
Building block for organic synthesis
4-Bromodibenzothiophene
Building block for organic synthesis
2,5-dimethyl furan-2,5-dicarboxylate
Building block for polymer synthesis
فلوريد رباعي بوتيل الأمونيوم
Phase-transfer catalyst and organic synthesis reagent
Tripropylene glycol diacrylate
UV-curable coatings and inks monomer
thiophene-2,5-dicarboxylic acid
YCGAZNXXGKTASZ-UHFFFAOYSA-N
C1=C(SC(=C1)C(=O)O)C(=O)O