1,2-Dihydro Dexamethasone is a steroidal compound that serves as an active pharmaceutical ingredient. Its structure features a fused four-ring steroid framework with multiple hydroxyl groups and a fluorine atom, contributing to its chemical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 426-17-5
Alpha-Cyclopentylmandelic acid
Glycopyrrolate related compound C reference standard
سيبروتيرون أسيتات
active pharmaceutical ingredient
Flumequine
fluoroquinolone antibiotic
Bevantolol hydrochloride
active pharmaceutical ingredient
FLUDROCORTISONE ACETATE
active pharmaceutical ingredient
Fluorogestone acetate
progestational hormone
(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
YYZXYYHUGHQGHI-CXSFZGCWSA-N
C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C