Perflubron is a perfluorocarbon-based haloalkane, specifically a bromine-substituted perfluorooctane, that serves as both a contrast agent for medical imaging and a synthetic blood substitute. Its key significance lies in its ability to carry oxygen and provide radioopacity, making it useful in diverse medical applications such as retinal detachment surgery and cell culture oxygen supply.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 423-55-2
1,2,3,4-Tetramethylcyclopentadiene
precursor for cyclopentadienyl ligands
Methyltriacetoxysilane
cross-linker for silicone sealants and adhesives
4,4-Dimethylcyclohexanone
chemical research intermediate
1,3,5-Triazine, 2-(2-(4-methoxyphenyl)ethenyl)-4,6-bis(trichloromethyl)-
Photoinitiator for UV-curable coatings
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane
WTWWXOGTJWMJHI-UHFFFAOYSA-N
C(C(C(C(C(F)(F)Br)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F