Bis(4-allyloxyphenyl)sulfone is a sulfone compound containing two allyloxyphenyl groups connected through a sulfonyl bridge. It is primarily used as a monomer in the synthesis of specialty polymers due to its reactive allyl ether groups and rigid aromatic core.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 41481-63-4
Irganox 1035
antioxidant for polymers and lubricants
Tris(4-isocyanatophenyl) thiophosphate
polyurethane crosslinking agent
1-Bromo-4-chloro-2-nitrobenzene
Industrial intermediate for synthesis
3-Chlorobenzylamine
Chemical intermediate for synthesis
Phenol, 4,4'-sulfonylbis[2-(2-propenyl)-
sulfonic acid derivative
5,5'-Sulfonylbis(1,3-dibromo-2-(2,3-dibromopropoxy)benzene)
flame retardant additive
2,4'-Dihydroxydiphenyl sulfone
sulfone monomer for polymer synthesis
3,3'-Dinitrodiphenyl sulfone
production of 3,3-diamino diphenyl sulfone
1-prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonylbenzene
JUNVYDTYJZSTKY-UHFFFAOYSA-N
C=CCOC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)OCC=C