Cromophtal yellow AGR is an anthraquinone-based pigment used primarily in ink and coating formulations. Its molecular structure features multiple aromatic rings and amine groups, contributing to its color properties and stability.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4118-16-5
Acid Violet 17
acid dye for textiles
4-Methoxy-2-methyldiphenylamine
Intermediate for thermal and pressure sensitive dyes
N-Methyl-4-nitrophthalimide
speciality pigment intermediate
2-Naphthalenecarboxamide, N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxy-
Naphthol AS dye coupling component
1-[[4-[(9,10-dioxoanthracen-1-yl)amino]-6-phenyl-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione
MVIFQPPFCHUSIH-UHFFFAOYSA-N
C1=CC=C(C=C1)C2=NC(=NC(=N2)NC3=CC=CC4=C3C(=O)C5=CC=CC=C5C4=O)NC6=CC=CC7=C6C(=O)C8=CC=CC=C8C7=O