1-(Phenylsulfonyl)-1H-indole is a sulfonamide compound used as a pharmaceutical intermediate in chemical synthesis. It features an indole ring bonded to a phenylsulfonyl group, contributing to its role in building more complex molecules for pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 40899-71-6
Methyl 4-acetamido-5-chloro-2-methoxybenzoate
Pharmaceutical intermediate
Ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate
Pharmaceutical intermediate
4-Aminopiperidine-4-carboxylic acid
Pharmaceutical intermediate for CELMoD synthesis
N-Methyl-2,2'-diaminodiethylamine
Pharmaceutical intermediate
1-(phenylsulfonyl)-1H-indol-3-ylboronic acid
boronic acid building block
1-(benzenesulfonyl)indole
VDWLCYCWLIKWBV-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC=CC=C32