3-Fluoro-4-nitrophenol is an aromatic organic compound containing both a fluorine atom and a nitro group on a phenol ring. It is primarily utilized as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 394-41-2
2,5-Difluoro-4-methoxyaniline
Pharmaceutical intermediate
Ethyl 3,4-dihydroxybenzoate
pharmaceutical intermediate
3-amino-4-cyclobutyl-2-hydroxybutanamide hydrochloride
pharmaceutical intermediate
(1R,2S,5S)-methyl 3-((S)-2-((tert-butoxycarbonyl)amino)-3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate
Boc-protected amino acid building block
3-fluoro-4-nitrophenol
CSSGKHVRDGATJL-UHFFFAOYSA-N
C1=CC(=C(C=C1O)F)[N+](=O)[O-]