4-Fluoro-2-nitrobenzoic acid is a fluorinated aromatic carboxylic acid used primarily as a building block in pharmaceutical manufacturing. Its structure combines a carboxylic acid group with a nitro group and a fluorine atom on a benzene ring, making it a valuable intermediate for synthesizing more complex drug compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 394-01-4
5-Fluoro-2-methoxybenzoic acid
Aurora A kinase inhibitor intermediate
2-Bromo-5-fluorobenzoic acid
pharmaceutical intermediate
5'-Fluoro-2'-hydroxyacetophenone
Pharmaceutical intermediate
Methyl 2-fluorobenzoate
dye, pesticide, pharmaceutical intermediates
4-fluoro-2-nitrobenzoic acid
YLUCXHMYRQUERW-UHFFFAOYSA-N
C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)O