This compound is a mixture of methanesulfonic acid and phosphorus pentoxide, commonly known as Eaton's reagent. It is primarily used as a reagent in organic synthesis, particularly for facilitating dehydrative cyclization reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 39394-84-8
حمض سلفونيك الميثان
Solvent, catalyst, and chemical intermediate
2-Fluorobenzonitrile
Building block for organic synthesis
E-504(II)
pulp and paper processing additive
1-[2,2-Bis(2-methylpropoxymethyl)butoxy]propan-2-amine
Polyurethane intermediate
8-Methoxy-8-oxooctanoic acid
chemical intermediate for synthesis
JHNLZOVBAQWGQU-UHFFFAOYSA-N
CS(=O)(=O)O.O=P(=O)OP(=O)=O