This compound is a fluorescent dye characterized by a xanthene core structure with diethylamino substituents and a methyl ester group. It is commonly used as a fluorescent label or tracer due to its bright emission properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 39393-39-0
3,6-Bis(diethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium tetrachlorozincate
Fluorescent solvent dye
3,6-Bis(diethylamino)-9-(2-(ethoxycarbonyl)phenyl)xanthylium chloride
Basic violet pigment
RHODAMINE B
Dye for paper and textiles
Rhodamine B Lake
purple pigment for coloring
Dimethyl 5-sulfoisophthalate sodium salt
sulfonate monomer for polyester dye
4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-1,1'-BIPHENYL
Fluorescent brightener
(1,1'-Bianthracene)-9,9',10,10'-tetrone, 4,4'-diamino-
anthraquinone pigment red 177
4-Chloro-1,8-naphthalic anhydride
Fluorescent solvent dye intermediate
[6-(diethylamino)-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium chloride
WODAOEIFNMQKIS-UHFFFAOYSA-M
CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)OC.[Cl-]