1,3-Adamantanedicarboxylic acid is a dicarboxylic acid derivative of adamantane used as a pharmaceutical intermediate. Its structure features two carboxylic acid groups on the adamantane cage, contributing to its utility in the synthesis of specialty chemicals.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 39269-10-8
3-Hydroxyadamantane-1-carboxylic acid
pharmaceutical intermediate
4-amino-2-(trifluoromethyl)benzoic Acid
Pharmaceutical intermediate for synthesis
4-Nitro-3-(trifluoromethyl)aniline
Metabolite of flutamide
5-amino-2-methoxybenzotrifluoride
Pharmaceutical intermediate
5-Bromo-2-fluorobenzotrifluoride
Pharmaceutical intermediate
adamantane-1,3-dicarboxylic acid
PAVQGHWQOQZQEH-UHFFFAOYSA-N
C1C2CC3(CC1CC(C2)(C3)C(=O)O)C(=O)O