3,4-Diaminobenzophenone is a chemical compound used as a pharmaceutical intermediate. It features a benzophenone core with two amine substituents, contributing to its role in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 39070-63-8
Thiomorpholine 1,1-dioxide
Pharmaceutical intermediate
3-Pyridinecarbonitrile, 1-butyl-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-
pharmaceutical intermediate
3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)benzoic acid
Pharmaceutical intermediate for cobimetinib
O-(2-(Vinyloxy)ethyl)hydroxylamine
Pharmaceutical intermediate for binimetinib synthesis
(3,4-diaminophenyl)-phenylmethanone
RXCOGDYOZQGGMK-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N