2-Fluoro-6-nitrobenzoic acid is a research compound with a structure featuring a carboxylic acid group, a fluorine atom, and a nitro group on an aromatic ring. Its physicochemical profile suggests moderate lipophilicity and a single hydrogen bond donor, indicating potential as a building block in synthetic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 385-02-4
Methylamine-15N hydrochloride
Isotopically labeled research compound
2-Mercaptopyrazine
research compound
(1,2,3,4,5,6,7,8-2H8)-9H-carbazole
isotope-labeled research compound
2-NITRODIPHENYL-D9
deuterated analytical reference standard
2-fluoro-6-nitrobenzoic acid
MPDZCNPDHUUPRL-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)C(=O)O)[N+](=O)[O-]