This compound is a chemical compound used as a high-performance polymer precursor. Its structure features multiple aromatic rings and ester groups, contributing to its utility in advanced material applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 38103-06-9
كلورات البوتاسيوم
Oxidizing agent for matches and explosives
Benzenesulfonic acid, 4-chloro-3,5-dinitro-, potassium salt
sulfonate salt intermediate for dyes
3,3,3-trifluoro-2-(trifluoromethyl)prop-1-ene
monomer for heat-stable copolymers
2,2,3,4,4,4-Hexafluorobutan-1-ol
fluorinated alcohol building block
5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]propan-2-yl]phenoxy]-2-benzofuran-1,3-dione
MQAHXEQUBNDFGI-UHFFFAOYSA-N
CC(C)(C1=CC=C(C=C1)OC2=CC3=C(C=C2)C(=O)OC3=O)C4=CC=C(C=C4)OC5=CC6=C(C=C5)C(=O)OC6=O