This compound is a deuterated derivative of naphthalene, specifically labeled with deuterium atoms at multiple positions including a trideuteriomethyl group. It is primarily used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 38072-94-5
Cyclopentanone-2,2,5,5-d4
Deuterated NMR reference standard
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine
Deuterated NMR reference standard
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
Diethylaminosulfur trifluoride
fluorinating reagent for organofluorine synthesis
Diethyl ((4-(3-fluorophenyl)-2-pyridyl)methyl) phosphonate
research compound
Phenylzinc bromide
organometallic reagent for cross-coupling
1-METHYLNAPHTHALENE
Solvent and chemical intermediate
1,2,3,4,5,6,7-heptadeuterio-8-(trideuteriomethyl)naphthalene
QPUYECUOLPXSFR-UZHHFJDZSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H]