Diethyl 1H-pyrazole-3,5-dicarboxylate is a research compound featuring a pyrazole ring with two ester substituents. Its structure has been confirmed by X-ray crystallography, and it is primarily used as a building block in organic synthesis and laboratory research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 37687-24-4
1,14-Dibromotetradecane
chemical intermediate for synthesis
Tetrafluorosuccinic acid
inhibitor of gluconeogenesis
6-Oxopiperidine-2-carboxylic acid
Bacterial metabolite research compound
Dehydroabietinol
abietane diterpenoid research compound
diethyl 1H-pyrazole-3,5-dicarboxylate
MBWXLICVQZUJOW-UHFFFAOYSA-N
CCOC(=O)C1=CC(=NN1)C(=O)OCC