Mycophenolate sodium is the sodium salt form of mycophenolic acid, an immunosuppressive compound used as a pharmaceutical raw material. It functions as an inhibitor of IMP dehydrogenase (EC 1.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 37415-62-6
Mycophenolate mofetil
immunosuppressive agent
Tacrolimus hydrate
immunosuppressive agent
L-Arginine acetylsalicylate
active pharmaceutical ingredient
Sulfisozole sodium
sulfonamide antibiotic
Amikacin
antibiotic active pharmaceutical ingredient
Acebutolol
active pharmaceutical ingredient
Mycophenolic Acid-d3
Deuterated internal standard for mycophenolic acid
6-[4-hydroxy-7-methyl-3-oxo-6-(trideuterio(113C)methoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid
Isotopically labeled active pharmaceutical ingredient
sodium (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate
DOZYTHNHLLSNIK-JOKMOOFLSA-M
CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)[O-])O.[Na+]