Validamycin is an agrochemical compound used as an antibiotic fungicide, primarily for controlling rice sheath blight. It is composed of multiple alcohol and other functional groups, contributing to its high polarity and water solubility.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 37248-47-8
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
Fenobucarb
Insecticide and pesticide
2-(2-methoxy-ethoxymethyl)-6-trifluoromethyl-nicotinic acid
Agrochemical metabolite
Streptomycin sulfate
antibiotic for bacterial infections
(2R,3R,4S,5S,6R)-2-[(1R,2R,3S,4S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-4-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
JARYYMUOCXVXNK-CSLFJTBJSA-N
C1[C@@H]([C@H]([C@@H]([C@H]([C@H]1N[C@H]2C=C([C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CO