Puerarin is a hydroxyisoflavone compound characterized by hydroxy groups at positions 7 and 4' and a beta-D-glucopyranosyl residue at position 8 via a C-glycosidic linkage. It is a research compound known for its antioxidant and anti-inflammatory properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3681-99-0
4-Aminophthalhydrazide
chemiluminescent label
4-Hydroxycyclohexanecarboxylic acid
human urinary metabolite research
Bicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic acid, 2-methyl ester
Research compound
2-fluoropyridine-4-carboxamide
research compound
7-hydroxy-3-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one
HKEAFJYKMMKDOR-VPRICQMDSA-N
C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O