Arginine ethyl ester hydrochloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients. It is the hydrochloride salt form of L-arginine ethyl ester, a derivative of the amino acid arginine.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 36589-29-4
Cis-N1-(tert-Butoxycarbonyl)-1,2-cyclohexanediamine
Pharmaceutical intermediate for chiral synthesis
Ethyl (1S,3R,4R)-3-{[(tert-butoxy)carbonyl]amino}-4-hydroxycyclohexane-1-carboxylate
Pharmaceutical intermediate for drug synthesis
1,1-Dimethylethyl N-[(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate
Pharmaceutical intermediate for edoxaban synthesis
3-Fluoro-4-methoxyaniline
pharmaceutical intermediate
ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride
DUCUWLZKZPQJDY-RGMNGODLSA-N
CCOC(=O)[C@H](CCCN=C(N)N)N.Cl