This compound is a chlorinated heterocyclic ester used as a pharmaceutical intermediate in the synthesis of nucleoside analogs. Its structure features multiple aromatic rings, ester linkages, and halogen substituents, contributing to its role in specialized organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3601-90-9
Hoffer's chlorosugar
intermediate for nucleoside synthesis
1-Chloro-3,5-di-O-toluoyl-2-deoxy-D-ribofuranose
Nucleoside synthesis intermediate
1,2-O-(1-methylethylidene)-4-C-[(phenylmethoxy)methyl]-3-O-(phenylmethyl)-L-Lyxofuranose
Pharmaceutical intermediate for nucleoside synthesis
((3aR,4R,6R,6aR)-2,2-Dimethyl-6-(2-oxo-4-(1H-1,2,4-triazol-1-yl)pyrimidin-1(2H)-yl)tetrahydro-2H-furo(3,4-d)(1,3)dioxol-4-yl)methyl 2-methylpropanoate
Pharmaceutical intermediate for nucleoside synthesis
N-Benzoyl-2'-deoxyadenosine
Pharmaceutical intermediate for nucleoside synthesis
Tert-Butyl N-hydroxycarbamate
pharmaceutical intermediate
Methyl 6-aminonicotinate
Pharmaceutical intermediate for drug synthesis
Methyl 6-aminopyridine-2-carboxylate
Pharmaceutical intermediate
[(2R,3S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate
QEHCZULNFYDPPL-RTKIROINSA-N
C1[C@@H]([C@H](OC1Cl)COC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl