FMOC-PHE (Fmoc-phenylalanine) is an Fmoc-protected amino acid used primarily as a research reagent for the formation of hydrogels. Its self-assembly properties enable the creation of structured peptide-based gel networks in aqueous conditions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35661-40-6
FMOC-PHE(4-NH2)-OH
Peptide building block intermediate
(s)-n-fmoc-4-chlorophenylalanine
Pharmaceutical intermediate for peptide synthesis
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)acetic acid
peptide synthesis reagent
4-iodo-3-nitrobenzoic acid
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
3,6-difluoropyrazine-2-carbonitrile
Research compound
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoic acid
Fmoc-protected amino acid reagent
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid
SJVFAHZPLIXNDH-QFIPXVFZSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24