2,5-bis(2,2,2-trifluoroethoxy)benzoic acid is a chemical compound used as a pharmaceutical intermediate in the synthesis of flecainide. It features a benzoic acid core with two trifluoroethoxy substituents, contributing to its role in pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35480-52-5
1-(2,5-bis(2,2,2-trifluoroethoxy)phenyl)ethanone
intermediate for agrochemical or pharmaceutical synthesis
2,2,2-trifluoroethyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate
research compound
Methyl 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylate 1,1-dioxide
pharmaceutical intermediate
2-Propenoic acid, 2-phosphonoxy-, tricyclohexylammonium salt
Phosphoenolpyruvate salt for biochemical research
N-Methyl-D-glucamine Hydrochloride
pharmaceutical intermediate
3-Chloro-1,1-diethoxypropane
pharmaceutical intermediate
2,5-bis(2,2,2-trifluoroethoxy)benzoic acid
YPGYLCZBZKRYQJ-UHFFFAOYSA-N
C1=CC(=C(C=C1OCC(F)(F)F)C(=O)O)OCC(F)(F)F