1-Chloroadamantane-d15 is a deuterated research compound where all hydrogen atoms in the adamantane structure are replaced with deuterium. It is primarily used as a labeled reagent in analytical and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 352431-55-1
3-(2-Bromo-4,5-dimethoxyphenyl)propanenitrile
research compound
(2-Mercaptophenyl)boronic acid
research compound
3-Chloro-2-fluorophenylboronic acid
Research reagent for organic synthesis
1-tert-butoxycarbonylaminocyclopentanecarboxylic acid
Building block for peptide synthesis
1-Chloroadamantane
pharmaceutical intermediate for amantadine synthesis
1-chloro-2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane
OZNXTQSXSHODFR-BXSQCBKHSA-N
[2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])Cl)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H]