Pentaerythritol triacrylate is an organic compound used as a monomer in polymer manufacturing. It is a tri-functional acrylate ester that can polymerize and is typically supplied with a polymerization inhibitor for stability.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3524-68-3
1-butanol
solvent and chemical intermediate
Boron trifluoride dimethyl etherate
esterification reagent for fats and oils
Carbonyl fluoride
organic synthesis intermediate
Tribromofluoromethane
fire extinguishing agent
[2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate
HVVWZTWDBSEWIH-UHFFFAOYSA-N
C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C