(3-Carbamoylphenyl)boronic acid is a boronic acid derivative featuring an amide substituent on the aromatic ring. It is primarily used as a research reagent in organic synthesis and medicinal chemistry, particularly for Suzuki-Miyaura cross-coupling reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 351422-73-6
3-Acetylphenylboronic acid
Boronic acid research reagent
4-Ethoxycarbonylphenylboronic acid
Boronic acid research reagent
N-Butylboronic acid
Boronic acid research reagent
Benzylboronic Acid
Boronic acid research reagent
1-(4-Methoxyphenyl)-2-methyl-2-propanol
research compound
N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,1,2,2-tetramethylethylenediamine
Schiff base ligand for metal complexation
(T-4)-[[2,2'-[(1R,2R)-1,2-Cyclohexanediylbis[(nitrilo-|EN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-|EO]](2-)]zinc
research reagent
CYCLOHEXYLMETHYLMAGNESIUM BROMIDE
Grignard reagent for organic synthesis
(3-carbamoylphenyl)boronic acid
WDGWHKRJEBENCE-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(=O)N)(O)O