This compound is a deuterated form of kynurenic acid, specifically labeled with deuterium atoms at five positions on the quinoline ring. It is primarily used as a research reagent in chemical and biochemical studies, particularly for tracing and analytical applications due to its isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 350820-13-2
3,5,6,7,8-pentadeuterio-4-hydroxyquinoline-2-carboxylic acid
HCZHHEIFKROPDY-RALIUCGRSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=N2)C(=O)O)[2H])O)[2H])[2H]