3-(Trifluoromethyl)benzylic alcohol is a chemical compound featuring a benzene ring substituted with a trifluoromethyl group and a hydroxymethyl group. It is commonly used as an intermediate in organic synthesis and pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 349-75-7
[3-(trifluoromethyl)phenyl]methanol
BXEHKCUWIODEDE-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(F)(F)F)CO