This compound is a salt-like iodonium-based chemical used as a pharmaceutical intermediate. It consists of an aromatic cation paired with a hexafluorophosphate anion.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 344562-80-7
3-(4-fluorophenyl)pentanedioic acid
Pharmaceutical intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
2-Chloro-5-fluoronitrobenzene
Pharmaceutical intermediate
2-Fluorobenzyl chloride
Pharmaceutical intermediate
Bis(p-tolyl)iodonium hexafluorophosphate
cationic photoinitiator
Diphenyliodonium nitrate
laboratory research reagent
2-(Phenyliodonio)benzoate hydrate
Pharmaceutical intermediate
Di(4-t-butylphenyl)iodonium camphorsulfonate
photoacid generator reagent
(4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium hexafluorophosphate
YNDYCGZWQZEBCS-UHFFFAOYSA-N
CC1=CC=C(C=C1)[I+]C2=CC=C(C=C2)CC(C)C.F[P-](F)(F)(F)(F)F