This compound is a deuterated research compound, specifically a decadeuterated dimethoxycyclohexane derivative. It is primarily used as a labeled reagent in laboratory research, where the incorporation of deuterium atoms facilitates studies in metabolic tracing and analytical chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 340257-57-0
Tryptamine-d4 Hydrochloride
labeled research reference standard
3-Methyl-5-isoxazolecarboxylic acid
research compound
Oxazole, 2,2'-(1,3-phenylene)bis[4,5-dihydro-
chemical research intermediate
(S)-1-N-Cbz-prolinamide
Protected proline derivative for peptide synthesis
1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane
MQTLTQMOALIWRO-UPEVGZBISA-N
[2H]C1(C(C(C(C(C1([2H])[2H])([2H])OC)([2H])[2H])([2H])OC)([2H])[2H])[2H]
—