5'-Thymidylic acid, disodium salt is the sodium salt form of thymidine monophosphate, a nucleotide derivative. It serves as a phosphorylated thymidine compound commonly used as a pharmaceutical intermediate in the synthesis of nucleotide-based products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 33430-62-5
Thymidine 5'-diphosphoric acid trisodium salt
nucleotide diphosphate intermediate
((2R,3S,5R)-3-Hydroxy-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-2-yl)methyl trihydrogen diphosphate disodium salt
nucleotide diphosphate research reagent
Thymidine 5'-triphosphate sodium salt
nucleotide triphosphate research reagent
Thymidine 5'-triphosphate sodium salt
Nucleotide triphosphate for molecular biology
4-[2-(3,4-Dihydro-7-methoxy-4,4-dimethyl-1,3-dioxo-2(1H)-isoquinolinyl)ethyl]benzenesulfonamide
pharmaceutical intermediate
6-Amino-2-methyl-5-nitropyrimidin-4(1H)-one
pharmaceutical intermediate
3-nitropyridine-2,6-diamine
Pharmaceutical intermediate
(3S)-piperidin-3-amine dihydrochloride
Pharmaceutical intermediate
disodium;[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate
AGSQMPPRYZYDFV-ZJWYQBPBSA-L
CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COP(=O)([O-])[O-])O.[Na+].[Na+]