3,5-Dichloro-4-hydroxybenzoic acid is a chlorinated aromatic carboxylic acid used primarily as a research reagent. It features a phenolic hydroxyl group and two chlorine substituents on the benzene ring, which contribute to its chemical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3336-41-2
Lipid Membrane Translocating Peptide
Cell-penetrating peptide tool
Spermidine trihydrochloride
biochemical research reagent
Pyrazinetetracarbonitrile
research reagent
11-Phenylundecanoic acid
Research compound for lipid studies
3,5-dichloro-4-hydroxybenzoic acid
AULKDLUOQCUNOK-UHFFFAOYSA-N
C1=C(C=C(C(=C1Cl)O)Cl)C(=O)O