Methyl (2R,3S)-N-benzoylphenylisoserinate is a pharmaceutical intermediate specifically used in the manufacturing process of the taxol side chain. This compound features a complex aromatic structure with alcohol and amide functional groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 32981-85-4
Ethyl (I+-R,I2S)-I2-(benzoylamino)-I+--hydroxybenzenepropanoate
pharmaceutical intermediate synthesis
10-Deacetylbaccatin III
Precursor to anti-cancer drug docetaxel
(1S)-2-chloro-1-(2,4-difluorophenyl)ethanol
pharmaceutical intermediate
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
1-(triphenylmethyl)-1H-imidazole-4-carbaldehyde
pharmaceutical intermediate
(2R,3S)-N-Benzoyl-3-phenylisoserine
Pharmaceutical intermediate for taxol synthesis
4-[[(5-Fluoro-2-methoxybenzoyl)amino]methyl]benzoic acid
Pirtobrutinib intermediate
N-(4-(2,2-Dicyano-1-hydroxyvinyl)benzyl)-5-fluoro-2-methoxybenzamide
Pharmaceutical intermediate
methyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate
UYJLJICUXJPKTB-LSDHHAIUSA-N
COC(=O)[C@@H]([C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)O