2,5-Bis(trifluoromethyl)aniline is a fluorinated aromatic amine compound used primarily as a pharmaceutical intermediate. Its structure features an aniline core with two trifluoromethyl groups, imparting distinct physicochemical properties such as moderate lipophilicity and low polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 328-93-8
Methyl 4-chloroacetoacetate
pharmaceutical intermediate
(4R)-N-(tert-Butyloxycarbonyl)-4-(cyanomethyl)-L-glutamic Acid 1,5-Dimethyl Ester
Pharmaceutical intermediate
Methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate
Pharmaceutical intermediate for antiviral synthesis
2,1,3-benzoxadiazole-4-carbaldehyde
pharmaceutical intermediate
2,5-bis(trifluoromethyl)aniline
XWMVIJUAZAEWIE-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)N)C(F)(F)F