2-Naphthylboronic acid is a boronic acid derivative used as a research reagent. It is commonly employed in organic synthesis and cross-coupling reactions due to its boronic acid functionality, which enables carbon-carbon bond formation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 32316-92-0
2-(Methylsulfonyl)phenylboronic acid
Boronic acid research reagent
4-Ethoxycarbonylphenylboronic acid
Boronic acid research reagent
N-Butylboronic acid
Boronic acid research reagent
Benzylboronic Acid
Boronic acid research reagent
4-Morpholineacetic Acid
Alpha-amino acid research compound
Mca-(Ala7,Lys(Dnp)9)-Bradykinin
fluorescent peptide substrate for enzyme assay
2-(Methylamino)-3-pyridinemethanol
Research compound
6-Fluoroisatin
Research compound
naphthalen-2-ylboronic acid
KPTRDYONBVUWPD-UHFFFAOYSA-N
B(C1=CC2=CC=CC=C2C=C1)(O)O