Melphalan hydrochloride is a bifunctional alkylating agent and a phenylalanine derivative of nitrogen mustard. It is converted into reactive intermediates that form crosslinks with DNA, inhibiting RNA transcription and protein synthesis, leading to cell growth arrest.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3223-07-2
ميلفالان
active pharmaceutical ingredient
L-Ornithine L-aspartate
amino acid based active pharmaceutical ingredient
N6-Hydroxymethyl Adefovir Dipivoxil
prodrug of adefovir
Sisomicin
aminoglycoside antibiotic
2-Methyl-ethinylestradiol
Active pharmaceutical ingredient
(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;hydrochloride
OUUYBRCCFUEMLH-YDALLXLXSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)N(CCCl)CCCl.Cl