2,2'-Dipyridyl-d8 is a deuterated form of 2,2'-dipyridyl, where all eight hydrogen atoms on the pyridine rings are replaced by deuterium. It is primarily used as a labeled research compound in analytical and synthetic chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 32190-42-4
BIS(ADAMANTAN-1-YL)(BUTYL)PHOSPHANE
phosphine ligand for cross-coupling catalysis
H-Asp(ome)-OMe HCl
amino acid ester research compound
Aflatoxin P1
mycotoxin reference standard
5-Methylnicotinic acid
research compound
2،2'-ثنائي بيريدين
Intermediate for herbicide diquat
(2,2'-Bipyridine)nickel(II) dibromide
catalyst for organic synthesis
Tris(2,2'-bipyridyl)dichlororuthenium(II) hexahydrate
Research reagent for photochemistry
(2,2'-Bipyridine)diiodonickel
research compound for catalysis
2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuterio-2-pyridinyl)pyridine
ROFVEXUMMXZLPA-PGRXLJNUSA-N
[2H]C1=C(C(=NC(=C1[2H])C2=C(C(=C(C(=N2)[2H])[2H])[2H])[2H])[2H])[2H]