This compound is a chemical compound featuring an isoindole-1,3-dione core with a 4-oxopentyl side chain. It is commonly supplied as a research reagent or intermediate for laboratory-scale synthesis and pharmaceutical manufacturing studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3197-25-9
2-(4-oxopentyl)isoindole-1,3-dione
DPATUMDQWSJANG-UHFFFAOYSA-N
CC(=O)CCCN1C(=O)C2=CC=CC=C2C1=O