2-Fluoro-3-nitrobenzoic acid is a fluorinated aromatic carboxylic acid commonly used as a pharmaceutical intermediate in the synthesis of drug compounds. Its structure includes both a nitro group and a fluorine atom on a benzoic acid ring, contributing to its reactivity in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 317-46-4
5-Chloromethyl-4-methyl-2-(4-trifluoromethyl-phenyl)-thiazole
pharmaceutical intermediate
Adrenaline EP Impurity E HCl
pharmaceutical reference impurity
2-methyl-4-[(2-methylbenzoyl)amino]Benzoic acid
Tolvaptan intermediate
(1,1'-Biphenyl)-4-carboxylic acid, (3aR,4S,5R,6aS)-hexahydro-4-(hydroxymethyl)-2-oxo-2H-cyclopenta(b)furan-5-yl ester
Pharmaceutical intermediate for prostaglandin synthesis
2-fluoro-3-nitrobenzoic acid
WLGUSLGYTNJJFV-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])F)C(=O)O