2-Propenoic acid, 2-methyl-, 4-hydroxyphenyl ester is an organic compound consisting of a methacrylate ester linked to a hydroxyphenyl group. It serves as a monomer for polymer synthesis, enabling the production of functionalized polymers.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 31480-93-0
Decyl methacrylate
monomer for polymer synthesis
1-isopropylcyclohexyl Methacrylate
monomer for polymer synthesis
BENZYL METHACRYLATE
monomer for polymer synthesis
2-Propenoic acid, 2-methyl-, 1-ethylcyclopentyl ester (9CI, ACI)
monomer for polymer synthesis
Methyl 4-chlorobutyrate
chemical intermediate for synthesis
2,4-Dibromotoluene
organic synthesis intermediate
Neodecanoic acid, sodium salt
Surfactant and lubricant additive
Tris(2,4-di-tert-butylphenyl) phosphite
antioxidant for plastics
(4-hydroxyphenyl) 2-methylprop-2-enoate
PJMXUSNWBKGQEZ-UHFFFAOYSA-N
CC(=C)C(=O)OC1=CC=C(C=C1)O