Ethyl 4-amino-3,5-dimethylbenzoate is a research compound characterized by an aromatic ring substituted with an amine group and an ester moiety. It is primarily used as a laboratory reagent in chemical and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3095-47-4
2-Bromo-9-fluorenone
research compound
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane;dichlororuthenium;N-methylmethanamine;hydrochloride
asymmetric hydrogenation catalyst
N-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-alanine
Research reagent for peptide synthesis
Dimethyl succinate-d4
deuterated analytical standard
ethyl 4-amino-3,5-dimethylbenzoate
GEMKGDSDLYAIRK-UHFFFAOYSA-N
CCOC(=O)C1=CC(=C(C(=C1)C)N)C