Methyl chenodeoxycholate is a methyl ester derivative of chenodeoxycholic acid, a naturally occurring bile acid. It serves as a pharmaceutical intermediate in the synthesis of modified bile acid derivatives for research and manufacturing applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3057-04-3
Chenodeoxycholic acid
bile acid for dissolving gallstones
Allochenodeoxycholic acid
cholanoid
4-tert-Butyl hydrogen L-aspartate
Pharmaceutical intermediate
N-Benzoyl-2'-deoxyadenosine
Pharmaceutical intermediate for nucleoside synthesis
Perfluorodecalin
artificial blood substitute component
5-Nitropicolinic acid
Pharmaceutical intermediate
methyl (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
GRQROVWZGGDYSW-IFJDUOSNSA-N
C[C@H](CCC(=O)OC)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C